C29H25N3O8S — CID 100925590
[(2R,3R,4R,5R)-4-acetyloxy-5-(4-amino-2-oxo-5-thiophen-3-ylpyrimidin-1-yl)-3-benzoyloxyoxolan-2-yl]methyl benzoate (PubChem CID 100925590) has the molecular formula C29H25N3O8S and a molecular weight of 575.60 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-acetyloxy-5-(4-amino-2-oxo-5-thiophen-3-ylpyrimidin-1-yl)-3-benzoyloxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-4-acetyloxy-5-(4-amino-2-oxo-5-thiophen-3-ylpyrimidin-1-yl)-3-benzoyloxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 100925590 |
| Molecular Formula | C29H25N3O8S |
| Molecular Weight | 575.60 g/mol |
| Exact Mass | 575.14 |
| IUPAC Name | [(2R,3R,4R,5R)-4-acetyloxy-5-(4-amino-2-oxo-5-thiophen-3-ylpyrimidin-1-yl)-3-benzoyloxyoxolan-2-yl]methyl benzoate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(=O)c2ccccc2)[C@@H](COC(=O)c2ccccc2)O[C@H]1n1cc(-c2ccsc2)c(N)nc1=O |
| InChI | InChI=1S/C29H25N3O8S/c1-17(33)38-24-23(40-28(35)19-10-6-3-7-11-19)22(15-37-27(34)18-8-4-2-5-9-18)39-26(24)32-14-21(20-12-13-41-16-20)25(30)31-29(32)36/h2-14,16,22-24,26H,15H2,1H3,(H2,30,31,36)/t22-,23-,24-,26-/m1/s1 |
| InChIKey | JPADPFNKIIVQHO-PMHJDTQVSA-N |
| XLogP | 3.47 |
| TPSA | 149.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.60 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|