C15H18FN3O8 — CID 102290076
[(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate (PubChem CID 102290076) has the molecular formula C15H18FN3O8 and a molecular weight of 387.32 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102290076 |
| Molecular Formula | C15H18FN3O8 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | [(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](n2cc(F)c(N)nc2=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H18FN3O8/c1-6(20)24-5-10-11(25-7(2)21)12(26-8(3)22)14(27-10)19-4-9(16)13(17)18-15(19)23/h4,10-12,14H,5H2,1-3H3,(H2,17,18,23)/t10-,11+,12+,14+/m1/s1 |
| InChIKey | DCHZIYNXLDDRGG-UHXUPSOCSA-N |
| XLogP | -0.71 |
| TPSA | 149.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|