C17H21N3O9 — CID 67461442
[(2R,3S,4R,5R)-5-(5-acetyl-4-amino-2-oxopyrimidin-1-yl)-3,4-diacetyloxyoxolan-2-yl]methyl acetate (PubChem CID 67461442) has the molecular formula C17H21N3O9 and a molecular weight of 411.37 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(5-acetyl-4-amino-2-oxopyrimidin-1-yl)-3,4-diacetyloxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-5-(5-acetyl-4-amino-2-oxopyrimidin-1-yl)-3,4-diacetyloxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 67461442 |
| Molecular Formula | C17H21N3O9 |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(5-acetyl-4-amino-2-oxopyrimidin-1-yl)-3,4-diacetyloxyoxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cc(C(C)=O)c(N)nc2=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C17H21N3O9/c1-7(21)11-5-20(17(25)19-15(11)18)16-14(28-10(4)24)13(27-9(3)23)12(29-16)6-26-8(2)22/h5,12-14,16H,6H2,1-4H3,(H2,18,19,25)/t12-,13+,14-,16-/m1/s1 |
| InChIKey | BTFFAHBZAXKUGP-HLPPOEQASA-N |
| XLogP | -0.65 |
| TPSA | 166.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|