C17H26N4O8Si — CID 59600113
[(2R,3S,5R)-3,4-diacetyloxy-5-[2-oxo-4-(trimethylsilylamino)-1,3,5-triazin-1-yl]oxolan-2-yl]methyl acetate (PubChem CID 59600113) has the molecular formula C17H26N4O8Si and a molecular weight of 442.50 g/mol. Its IUPAC name is [(2R,3S,5R)-3,4-diacetyloxy-5-[2-oxo-4-(trimethylsilylamino)-1,3,5-triazin-1-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,5R)-3,4-diacetyloxy-5-[2-oxo-4-(trimethylsilylamino)-1,3,5-triazin-1-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 59600113 |
| Molecular Formula | C17H26N4O8Si |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | [(2R,3S,5R)-3,4-diacetyloxy-5-[2-oxo-4-(trimethylsilylamino)-1,3,5-triazin-1-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc(N[Si](C)(C)C)nc2=O)C(OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C17H26N4O8Si/c1-9(22)26-7-12-13(27-10(2)23)14(28-11(3)24)15(29-12)21-8-18-16(19-17(21)25)20-30(4,5)6/h8,12-15H,7H2,1-6H3,(H,19,20,25)/t12-,13+,14?,15-/m1/s1 |
| InChIKey | RYINIUDTVIYQSU-IZGVIRRGSA-N |
| XLogP | 0.21 |
| TPSA | 147.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|