C18H23N3O10S — CID 102411723
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-methylsulfanyl-2-oxo-1,3,5-triazin-1-yl)oxan-2-yl]methyl acetate (PubChem CID 102411723) has the molecular formula C18H23N3O10S and a molecular weight of 473.46 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-methylsulfanyl-2-oxo-1,3,5-triazin-1-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-methylsulfanyl-2-oxo-1,3,5-triazin-1-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102411723 |
| Molecular Formula | C18H23N3O10S |
| Molecular Weight | 473.46 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-methylsulfanyl-2-oxo-1,3,5-triazin-1-yl)oxan-2-yl]methyl acetate |
| SMILES | CSc1ncn([C@@H]2O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)c(=O)n1 |
| InChI | InChI=1S/C18H23N3O10S/c1-8(22)27-6-12-13(28-9(2)23)14(29-10(3)24)15(30-11(4)25)16(31-12)21-7-19-17(32-5)20-18(21)26/h7,12-16H,6H2,1-5H3/t12-,13+,14+,15-,16-/m1/s1 |
| InChIKey | HHXHPWCUJUARFA-LYYZXLFJSA-N |
| XLogP | -0.38 |
| TPSA | 162.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.46 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|