C17H24N4O8S — CID 122521990
[(2R,4S,5R)-3,4-diacetyloxy-5-[2-oxo-4-(propan-2-ylsulfanylamino)-1,3,5-triazin-1-yl]oxolan-2-yl]methyl acetate (PubChem CID 122521990) has the molecular formula C17H24N4O8S and a molecular weight of 444.47 g/mol. Its IUPAC name is [(2R,4S,5R)-3,4-diacetyloxy-5-[2-oxo-4-(propan-2-ylsulfanylamino)-1,3,5-triazin-1-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,4S,5R)-3,4-diacetyloxy-5-[2-oxo-4-(propan-2-ylsulfanylamino)-1,3,5-triazin-1-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 122521990 |
| Molecular Formula | C17H24N4O8S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | [(2R,4S,5R)-3,4-diacetyloxy-5-[2-oxo-4-(propan-2-ylsulfanylamino)-1,3,5-triazin-1-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc(NSC(C)C)nc2=O)[C@@H](OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C17H24N4O8S/c1-8(2)30-20-16-18-7-21(17(25)19-16)15-14(28-11(5)24)13(27-10(4)23)12(29-15)6-26-9(3)22/h7-8,12-15H,6H2,1-5H3,(H,19,20,25)/t12-,13?,14+,15-/m1/s1 |
| InChIKey | RSQSXDIDHUYJSF-FSJTYKKLSA-N |
| XLogP | 0.43 |
| TPSA | 147.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|