C22H27FN4O7 — CID 154716339
[(2S,3R,4R)-3,4-diacetyloxy-5-(6-cyclohexyl-2-fluoropurin-9-yl)oxolan-2-yl]methyl acetate (PubChem CID 154716339) has the molecular formula C22H27FN4O7 and a molecular weight of 478.48 g/mol. Its IUPAC name is [(2S,3R,4R)-3,4-diacetyloxy-5-(6-cyclohexyl-2-fluoropurin-9-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4R)-3,4-diacetyloxy-5-(6-cyclohexyl-2-fluoropurin-9-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 154716339 |
| Molecular Formula | C22H27FN4O7 |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | [(2S,3R,4R)-3,4-diacetyloxy-5-(6-cyclohexyl-2-fluoropurin-9-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1OC(n2cnc3c(C4CCCCC4)nc(F)nc32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H27FN4O7/c1-11(28)31-9-15-18(32-12(2)29)19(33-13(3)30)21(34-15)27-10-24-17-16(14-7-5-4-6-8-14)25-22(23)26-20(17)27/h10,14-15,18-19,21H,4-9H2,1-3H3/t15-,18+,19+,21?/m0/s1 |
| InChIKey | HXXZFWNXOIXQCW-NLKFNBDYSA-N |
| XLogP | 2.34 |
| TPSA | 131.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|