C22H26N6O7 — CID 66911698
[3,4-diacetyloxy-5-[2-cyano-6-(cyclopentylamino)purin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 66911698) has the molecular formula C22H26N6O7 and a molecular weight of 486.49 g/mol. Its IUPAC name is [3,4-diacetyloxy-5-[2-cyano-6-(cyclopentylamino)purin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [3,4-diacetyloxy-5-[2-cyano-6-(cyclopentylamino)purin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 66911698 |
| Molecular Formula | C22H26N6O7 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | [3,4-diacetyloxy-5-[2-cyano-6-(cyclopentylamino)purin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(n2cnc3c(NC4CCCC4)nc(C#N)nc32)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C22H26N6O7/c1-11(29)32-9-15-18(33-12(2)30)19(34-13(3)31)22(35-15)28-10-24-17-20(25-14-6-4-5-7-14)26-16(8-23)27-21(17)28/h10,14-15,18-19,22H,4-7,9H2,1-3H3,(H,25,26,27) |
| InChIKey | PTZQEPAEVDVNRR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 167.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|