C24H23ClN6O7 — CID 69195945
[3,4-diacetyloxy-5-[6-[(4-chlorophenyl)methylamino]-2-cyanopurin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 69195945) has the molecular formula C24H23ClN6O7 and a molecular weight of 542.94 g/mol. Its IUPAC name is [3,4-diacetyloxy-5-[6-[(4-chlorophenyl)methylamino]-2-cyanopurin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [3,4-diacetyloxy-5-[6-[(4-chlorophenyl)methylamino]-2-cyanopurin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 69195945 |
| Molecular Formula | C24H23ClN6O7 |
| Molecular Weight | 542.94 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | [3,4-diacetyloxy-5-[6-[(4-chlorophenyl)methylamino]-2-cyanopurin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(n2cnc3c(NCc4ccc(Cl)cc4)nc(C#N)nc32)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C24H23ClN6O7/c1-12(32)35-10-17-20(36-13(2)33)21(37-14(3)34)24(38-17)31-11-28-19-22(29-18(8-26)30-23(19)31)27-9-15-4-6-16(25)7-5-15/h4-7,11,17,20-21,24H,9-10H2,1-3H3,(H,27,29,30) |
| InChIKey | XALWKHCXWSWVIK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 167.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.94 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|