C21H21N7O7 — CID 69197910
[(2S,3R,4R,5R)-3,4-diacetyloxy-5-[2-cyano-6-(1H-pyrrol-3-ylamino)purin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 69197910) has the molecular formula C21H21N7O7 and a molecular weight of 483.44 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-3,4-diacetyloxy-5-[2-cyano-6-(1H-pyrrol-3-ylamino)purin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4R,5R)-3,4-diacetyloxy-5-[2-cyano-6-(1H-pyrrol-3-ylamino)purin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 69197910 |
| Molecular Formula | C21H21N7O7 |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | [(2S,3R,4R,5R)-3,4-diacetyloxy-5-[2-cyano-6-(1H-pyrrol-3-ylamino)purin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@@H](n2cnc3c(Nc4cc[nH]c4)nc(C#N)nc32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H21N7O7/c1-10(29)32-8-14-17(33-11(2)30)18(34-12(3)31)21(35-14)28-9-24-16-19(25-13-4-5-23-7-13)26-15(6-22)27-20(16)28/h4-5,7,9,14,17-18,21,23H,8H2,1-3H3,(H,25,26,27)/t14-,17+,18+,21+/m0/s1 |
| InChIKey | BDNJLSFUYYLZEE-QMLHBMHXSA-N |
| XLogP | 1.09 |
| TPSA | 183.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|