C23H25N9O8 — CID 135404164
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-anilino-2-[(E)-(carbamoylamino)diazenyl]purin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 135404164) has the molecular formula C23H25N9O8 and a molecular weight of 555.51 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-anilino-2-[(E)-(carbamoylamino)diazenyl]purin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-anilino-2-[(E)-(carbamoylamino)diazenyl]purin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135404164 |
| Molecular Formula | C23H25N9O8 |
| Molecular Weight | 555.51 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-anilino-2-[(E)-(carbamoylamino)diazenyl]purin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c(Nc4ccccc4)nc(/N=N/NC(N)=O)nc32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H25N9O8/c1-11(33)37-9-15-17(38-12(2)34)18(39-13(3)35)21(40-15)32-10-25-16-19(26-14-7-5-4-6-8-14)27-23(28-20(16)32)30-31-29-22(24)36/h4-8,10,15,17-18,21H,9H2,1-3H3,(H4,24,26,27,28,29,30,36)/t15-,17-,18-,21-/m1/s1 |
| InChIKey | VKTWGWYEHRSKJJ-QTQZEZTPSA-N |
| XLogP | 1.56 |
| TPSA | 223.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.51 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|