C24H26N6O9 — CID 59818087
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-nitro-6-(2-phenylethylamino)purin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 59818087) has the molecular formula C24H26N6O9 and a molecular weight of 542.51 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-nitro-6-(2-phenylethylamino)purin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-nitro-6-(2-phenylethylamino)purin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 59818087 |
| Molecular Formula | C24H26N6O9 |
| Molecular Weight | 542.51 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-nitro-6-(2-phenylethylamino)purin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c(NCCc4ccccc4)nc([N+](=O)[O-])nc32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H26N6O9/c1-13(31)36-11-17-19(37-14(2)32)20(38-15(3)33)23(39-17)29-12-26-18-21(27-24(30(34)35)28-22(18)29)25-10-9-16-7-5-4-6-8-16/h4-8,12,17,19-20,23H,9-11H2,1-3H3,(H,25,27,28)/t17-,19-,20-,23-/m1/s1 |
| InChIKey | OHWUPLHKEQPPTI-ZDXOVATRSA-N |
| XLogP | 1.71 |
| TPSA | 186.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.51 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|