C34H37ClN6O7 — CID 86623492
[(2R,3R,4S,5R)-3,4-diacetyloxy-5-[2-[3-[(4-chlorophenyl)methyl]azetidin-1-yl]-6-(2-phenylethylamino)purin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 86623492) has the molecular formula C34H37ClN6O7 and a molecular weight of 677.16 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4-diacetyloxy-5-[2-[3-[(4-chlorophenyl)methyl]azetidin-1-yl]-6-(2-phenylethylamino)purin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4-diacetyloxy-5-[2-[3-[(4-chlorophenyl)methyl]azetidin-1-yl]-6-(2-phenylethylamino)purin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 86623492 |
| Molecular Formula | C34H37ClN6O7 |
| Molecular Weight | 677.16 g/mol |
| Exact Mass | 676.24 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4-diacetyloxy-5-[2-[3-[(4-chlorophenyl)methyl]azetidin-1-yl]-6-(2-phenylethylamino)purin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c(NCCc4ccccc4)nc(N4CC(Cc5ccc(Cl)cc5)C4)nc32)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C34H37ClN6O7/c1-20(42)45-18-27-29(46-21(2)43)30(47-22(3)44)33(48-27)41-19-37-28-31(36-14-13-23-7-5-4-6-8-23)38-34(39-32(28)41)40-16-25(17-40)15-24-9-11-26(35)12-10-24/h4-12,19,25,27,29-30,33H,13-18H2,1-3H3,(H,36,38,39)/t27-,29-,30+,33-/m1/s1 |
| InChIKey | WYDRCHQCYWCSIZ-ZTNDKSNBSA-N |
| XLogP | 4.14 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.16 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|