C32H32ClN5O7 — CID 174178643
[3,4-diacetyloxy-5-[2-chloro-6-(3,4-diphenylpyrrolidin-1-yl)purin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 174178643) has the molecular formula C32H32ClN5O7 and a molecular weight of 634.09 g/mol. Its IUPAC name is [3,4-diacetyloxy-5-[2-chloro-6-(3,4-diphenylpyrrolidin-1-yl)purin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [3,4-diacetyloxy-5-[2-chloro-6-(3,4-diphenylpyrrolidin-1-yl)purin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 174178643 |
| Molecular Formula | C32H32ClN5O7 |
| Molecular Weight | 634.09 g/mol |
| Exact Mass | 633.20 |
| IUPAC Name | [3,4-diacetyloxy-5-[2-chloro-6-(3,4-diphenylpyrrolidin-1-yl)purin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(n2cnc3c(N4CC(c5ccccc5)C(c5ccccc5)C4)nc(Cl)nc32)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C32H32ClN5O7/c1-18(39)42-16-25-27(43-19(2)40)28(44-20(3)41)31(45-25)38-17-34-26-29(35-32(33)36-30(26)38)37-14-23(21-10-6-4-7-11-21)24(15-37)22-12-8-5-9-13-22/h4-13,17,23-25,27-28,31H,14-16H2,1-3H3 |
| InChIKey | JSVPGFZUGAPWBX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 134.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.09 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|