C28H29ClFN5O7 — CID 169057909
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-chloro-6-(5-fluorospiro[2H-indole-3,1'-cyclopentane]-1-yl)purin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 169057909) has the molecular formula C28H29ClFN5O7 and a molecular weight of 602.02 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-chloro-6-(5-fluorospiro[2H-indole-3,1'-cyclopentane]-1-yl)purin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-chloro-6-(5-fluorospiro[2H-indole-3,1'-cyclopentane]-1-yl)purin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 169057909 |
| Molecular Formula | C28H29ClFN5O7 |
| Molecular Weight | 602.02 g/mol |
| Exact Mass | 601.17 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-chloro-6-(5-fluorospiro[2H-indole-3,1'-cyclopentane]-1-yl)purin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c(N4CC5(CCCC5)c5cc(F)ccc54)nc(Cl)nc32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H29ClFN5O7/c1-14(36)39-11-20-22(40-15(2)37)23(41-16(3)38)26(42-20)35-13-31-21-24(32-27(29)33-25(21)35)34-12-28(8-4-5-9-28)18-10-17(30)6-7-19(18)34/h6-7,10,13,20,22-23,26H,4-5,8-9,11-12H2,1-3H3/t20-,22-,23-,26-/m1/s1 |
| InChIKey | SUZAOOIBCODRGQ-HUBRGWSESA-N |
| XLogP | 3.91 |
| TPSA | 134.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.02 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|