C23H28ClN5O9P2 — CID 169057766
[[(2R,4S,5R)-5-(2-chloro-6-spiro[2H-indole-3,1'-cyclopentane]-1-ylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 169057766) has the molecular formula C23H28ClN5O9P2 and a molecular weight of 615.90 g/mol. Its IUPAC name is [[(2R,4S,5R)-5-(2-chloro-6-spiro[2H-indole-3,1'-cyclopentane]-1-ylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,4S,5R)-5-(2-chloro-6-spiro[2H-indole-3,1'-cyclopentane]-1-ylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 169057766 |
| Molecular Formula | C23H28ClN5O9P2 |
| Molecular Weight | 615.90 g/mol |
| Exact Mass | 615.11 |
| IUPAC Name | [[(2R,4S,5R)-5-(2-chloro-6-spiro[2H-indole-3,1'-cyclopentane]-1-ylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N4CC5(CCCC5)c5ccccc54)nc(Cl)nc32)[C@@H](O)C1O |
| InChI | InChI=1S/C23H28ClN5O9P2/c24-22-26-19(28-10-23(7-3-4-8-23)13-5-1-2-6-14(13)28)16-20(27-22)29(11-25-16)21-18(31)17(30)15(38-21)9-37-40(35,36)12-39(32,33)34/h1-2,5-6,11,15,17-18,21,30-31H,3-4,7-10,12H2,(H,35,36)(H2,32,33,34)/t15-,17?,18+,21-/m1/s1 |
| InChIKey | QPEZYHGQFLSPAO-IPZUKPMBSA-N |
| XLogP | 2.40 |
| TPSA | 200.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.90 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|