C23H27ClFN5O9P2 — CID 169057681
[[(2R,3R,5R)-5-[2-chloro-6-(4-fluorospiro[2H-indole-3,1'-cyclopentane]-1-yl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 169057681) has the molecular formula C23H27ClFN5O9P2 and a molecular weight of 633.89 g/mol. Its IUPAC name is [[(2R,3R,5R)-5-[2-chloro-6-(4-fluorospiro[2H-indole-3,1'-cyclopentane]-1-yl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3R,5R)-5-[2-chloro-6-(4-fluorospiro[2H-indole-3,1'-cyclopentane]-1-yl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 169057681 |
| Molecular Formula | C23H27ClFN5O9P2 |
| Molecular Weight | 633.89 g/mol |
| Exact Mass | 633.10 |
| IUPAC Name | [[(2R,3R,5R)-5-[2-chloro-6-(4-fluorospiro[2H-indole-3,1'-cyclopentane]-1-yl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N4CC5(CCCC5)c5c(F)cccc54)nc(Cl)nc32)C(O)[C@H]1O |
| InChI | InChI=1S/C23H27ClFN5O9P2/c24-22-27-19(29-9-23(6-1-2-7-23)15-12(25)4-3-5-13(15)29)16-20(28-22)30(10-26-16)21-18(32)17(31)14(39-21)8-38-41(36,37)11-40(33,34)35/h3-5,10,14,17-18,21,31-32H,1-2,6-9,11H2,(H,36,37)(H2,33,34,35)/t14-,17+,18?,21-/m1/s1 |
| InChIKey | MNSJEAQJNKKVFI-JUVGHTGDSA-N |
| XLogP | 2.54 |
| TPSA | 200.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.89 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|