C22H23ClFN5O4 — CID 169057765
(2R,3R,4S,5R)-2-[2-chloro-6-(6-fluorospiro[2H-indole-3,1'-cyclopentane]-1-yl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 169057765) has the molecular formula C22H23ClFN5O4 and a molecular weight of 475.91 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[2-chloro-6-(6-fluorospiro[2H-indole-3,1'-cyclopentane]-1-yl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[2-chloro-6-(6-fluorospiro[2H-indole-3,1'-cyclopentane]-1-yl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 169057765 |
| Molecular Formula | C22H23ClFN5O4 |
| Molecular Weight | 475.91 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | (2R,3R,4S,5R)-2-[2-chloro-6-(6-fluorospiro[2H-indole-3,1'-cyclopentane]-1-yl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(N4CC5(CCCC5)c5ccc(F)cc54)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H23ClFN5O4/c23-21-26-18(28-9-22(5-1-2-6-22)12-4-3-11(24)7-13(12)28)15-19(27-21)29(10-25-15)20-17(32)16(31)14(8-30)33-20/h3-4,7,10,14,16-17,20,30-32H,1-2,5-6,8-9H2/t14-,16-,17-,20-/m1/s1 |
| InChIKey | NIIOVDJEYQAJIN-WVSUBDOOSA-N |
| XLogP | 2.19 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.91 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |