C21H21ClFN5O4 — CID 169057714
(2R,4R,5R)-2-[2-chloro-6-(4-fluorospiro[1,3-dihydroindene-2,3'-azetidine]-1'-yl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 169057714) has the molecular formula C21H21ClFN5O4 and a molecular weight of 461.88 g/mol. Its IUPAC name is (2R,4R,5R)-2-[2-chloro-6-(4-fluorospiro[1,3-dihydroindene-2,3'-azetidine]-1'-yl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,4R,5R)-2-[2-chloro-6-(4-fluorospiro[1,3-dihydroindene-2,3'-azetidine]-1'-yl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 169057714 |
| Molecular Formula | C21H21ClFN5O4 |
| Molecular Weight | 461.88 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | (2R,4R,5R)-2-[2-chloro-6-(4-fluorospiro[1,3-dihydroindene-2,3'-azetidine]-1'-yl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(N4CC5(Cc6cccc(F)c6C5)C4)nc(Cl)nc32)C(O)[C@H]1O |
| InChI | InChI=1S/C21H21ClFN5O4/c22-20-25-17(27-7-21(8-27)4-10-2-1-3-12(23)11(10)5-21)14-18(26-20)28(9-24-14)19-16(31)15(30)13(6-29)32-19/h1-3,9,13,15-16,19,29-31H,4-8H2/t13-,15+,16?,19-/m1/s1 |
| InChIKey | VJJIXBAYLBFCOA-VXSJHCPZSA-N |
| XLogP | 0.84 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.88 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |