C28H26ClN5O4 — CID 175234468
(2R,3R,4S,5R)-2-[2-chloro-6-(3,3-diphenyl-2H-azepin-1-yl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 175234468) has the molecular formula C28H26ClN5O4 and a molecular weight of 532.00 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[2-chloro-6-(3,3-diphenyl-2H-azepin-1-yl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[2-chloro-6-(3,3-diphenyl-2H-azepin-1-yl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 175234468 |
| Molecular Formula | C28H26ClN5O4 |
| Molecular Weight | 532.00 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | (2R,3R,4S,5R)-2-[2-chloro-6-(3,3-diphenyl-2H-azepin-1-yl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(N4C=CC=CC(c5ccccc5)(c5ccccc5)C4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H26ClN5O4/c29-27-31-24(21-25(32-27)34(17-30-21)26-23(37)22(36)20(15-35)38-26)33-14-8-7-13-28(16-33,18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-14,17,20,22-23,26,35-37H,15-16H2/t20-,22-,23-,26-/m1/s1 |
| InChIKey | ZNLKNNNSKOOCHV-HUBRGWSESA-N |
| XLogP | 2.97 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.00 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |