C24H26ClN5O4 — CID 169057819
[(3aS,4R,6R)-4-(2-chloro-6-spiro[2H-indole-3,1'-cyclobutane]-1-ylpurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol (PubChem CID 169057819) has the molecular formula C24H26ClN5O4 and a molecular weight of 483.96 g/mol. Its IUPAC name is [(3aS,4R,6R)-4-(2-chloro-6-spiro[2H-indole-3,1'-cyclobutane]-1-ylpurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol.
| Compound Name | [(3aS,4R,6R)-4-(2-chloro-6-spiro[2H-indole-3,1'-cyclobutane]-1-ylpurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 169057819 |
| Molecular Formula | C24H26ClN5O4 |
| Molecular Weight | 483.96 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | [(3aS,4R,6R)-4-(2-chloro-6-spiro[2H-indole-3,1'-cyclobutane]-1-ylpurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
| SMILES | CC1(C)OC2[C@@H](CO)O[C@@H](n3cnc4c(N5CC6(CCC6)c6ccccc65)nc(Cl)nc43)[C@H]2O1 |
| InChI | InChI=1S/C24H26ClN5O4/c1-23(2)33-17-15(10-31)32-21(18(17)34-23)30-12-26-16-19(27-22(25)28-20(16)30)29-11-24(8-5-9-24)13-6-3-4-7-14(13)29/h3-4,6-7,12,15,17-18,21,31H,5,8-11H2,1-2H3/t15-,17?,18+,21-/m1/s1 |
| InChIKey | PEZTVQGZJKVGRJ-IPZUKPMBSA-N |
| XLogP | 3.46 |
| TPSA | 94.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.96 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |