C24H28ClN5O4 — CID 169057756
[(4R,6R,6aS)-4-[2-chloro-6-(4-phenylpiperidin-1-yl)purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol (PubChem CID 169057756) has the molecular formula C24H28ClN5O4 and a molecular weight of 485.97 g/mol. Its IUPAC name is [(4R,6R,6aS)-4-[2-chloro-6-(4-phenylpiperidin-1-yl)purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol.
| Compound Name | [(4R,6R,6aS)-4-[2-chloro-6-(4-phenylpiperidin-1-yl)purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 169057756 |
| Molecular Formula | C24H28ClN5O4 |
| Molecular Weight | 485.97 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | [(4R,6R,6aS)-4-[2-chloro-6-(4-phenylpiperidin-1-yl)purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
| SMILES | CC1(C)OC2[C@@H](O1)[C@@H](CO)O[C@H]2n1cnc2c(N3CCC(c4ccccc4)CC3)nc(Cl)nc21 |
| InChI | InChI=1S/C24H28ClN5O4/c1-24(2)33-18-16(12-31)32-22(19(18)34-24)30-13-26-17-20(27-23(25)28-21(17)30)29-10-8-15(9-11-29)14-6-4-3-5-7-14/h3-7,13,15-16,18-19,22,31H,8-12H2,1-2H3/t16-,18+,19?,22-/m1/s1 |
| InChIKey | ZQDOUMPBSHRNOA-GNIVAGDMSA-N |
| XLogP | 3.27 |
| TPSA | 94.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.97 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |