C14H15ClN5O5Rb — CID 58085652
[[6-chloro-9-[6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-2-yl]amino]methanone;rubidium(1+) (PubChem CID 58085652) has the molecular formula C14H15ClN5O5Rb and a molecular weight of 454.23 g/mol. Its IUPAC name is [[6-chloro-9-[6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-2-yl]amino]methanone;rubidium(1+).
| Compound Name | [[6-chloro-9-[6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-2-yl]amino]methanone;rubidium(1+) |
|---|---|
| PubChem CID | 58085652 |
| Molecular Formula | C14H15ClN5O5Rb |
| Molecular Weight | 454.23 g/mol |
| Exact Mass | 452.99 |
| IUPAC Name | [[6-chloro-9-[6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-2-yl]amino]methanone;rubidium(1+) |
| SMILES | CC1(C)OC2C(CO)OC(n3cnc4c(Cl)nc(N[C-]=O)nc43)C2O1.[Rb+] |
| InChI | InChI=1S/C14H15ClN5O5.Rb/c1-14(2)24-8-6(3-21)23-12(9(8)25-14)20-4-16-7-10(15)18-13(17-5-22)19-11(7)20;/h4,6,8-9,12,21H,3H2,1-2H3,(H,17,18,19,22);/q-1;+1 |
| InChIKey | ZZGBCADYTVXVBC-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.23 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|