C18H26N4O6 — CID 11132994
9-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1-(5-hydroxypentyl)purin-6-one (PubChem CID 11132994) has the molecular formula C18H26N4O6 and a molecular weight of 394.43 g/mol. Its IUPAC name is 9-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1-(5-hydroxypentyl)purin-6-one.
| Compound Name | 9-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1-(5-hydroxypentyl)purin-6-one |
|---|---|
| PubChem CID | 11132994 |
| Molecular Formula | C18H26N4O6 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 9-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1-(5-hydroxypentyl)purin-6-one |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CO)O[C@H]2n1cnc2c(=O)n(CCCCCO)cnc21 |
| InChI | InChI=1S/C18H26N4O6/c1-18(2)27-13-11(8-24)26-17(14(13)28-18)22-10-19-12-15(22)20-9-21(16(12)25)6-4-3-5-7-23/h9-11,13-14,17,23-24H,3-8H2,1-2H3/t11-,13-,14-,17-/m1/s1 |
| InChIKey | KVCYRZDJWVPTET-LSCFUAHRSA-N |
| XLogP | 0.17 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|