C19H26N4O7 — CID 50901670
[9-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-oxopurin-1-yl]methyl 2,2-dimethylpropanoate (PubChem CID 50901670) has the molecular formula C19H26N4O7 and a molecular weight of 422.44 g/mol. Its IUPAC name is [9-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-oxopurin-1-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [9-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-oxopurin-1-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 50901670 |
| Molecular Formula | C19H26N4O7 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | [9-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-oxopurin-1-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CO)O[C@H]2n1cnc2c(=O)n(COC(=O)C(C)(C)C)cnc21 |
| InChI | InChI=1S/C19H26N4O7/c1-18(2,3)17(26)27-9-22-7-21-14-11(15(22)25)20-8-23(14)16-13-12(10(6-24)28-16)29-19(4,5)30-13/h7-8,10,12-13,16,24H,6,9H2,1-5H3/t10-,12-,13-,16-/m1/s1 |
| InChIKey | YNIWKVNQHZPQPE-XNIJJKJLSA-N |
| XLogP | 0.55 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |