C15H19ClN4O4 — CID 90749132
9-[(3aR,6R,6aR)-6-(methoxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-chloro-2-methylpurine (PubChem CID 90749132) has the molecular formula C15H19ClN4O4 and a molecular weight of 354.79 g/mol. Its IUPAC name is 9-[(3aR,6R,6aR)-6-(methoxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-chloro-2-methylpurine.
| Compound Name | 9-[(3aR,6R,6aR)-6-(methoxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-chloro-2-methylpurine |
|---|---|
| PubChem CID | 90749132 |
| Molecular Formula | C15H19ClN4O4 |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 9-[(3aR,6R,6aR)-6-(methoxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-chloro-2-methylpurine |
| SMILES | COC[C@H]1OC(n2cnc3c(Cl)nc(C)nc32)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C15H19ClN4O4/c1-7-18-12(16)9-13(19-7)20(6-17-9)14-11-10(8(22-14)5-21-4)23-15(2,3)24-11/h6,8,10-11,14H,5H2,1-4H3/t8-,10-,11-,14?/m1/s1 |
| InChIKey | WBVHZZODFDYENT-OYBGHCQBSA-N |
| XLogP | 1.85 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |