C14H15ClF3N5O6S — CID 86691799
[(3aR,4R,6R,6aR)-4-(6-amino-2-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl trifluoromethanesulfonate (PubChem CID 86691799) has the molecular formula C14H15ClF3N5O6S and a molecular weight of 473.82 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-(6-amino-2-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl trifluoromethanesulfonate.
| Compound Name | [(3aR,4R,6R,6aR)-4-(6-amino-2-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86691799 |
| Molecular Formula | C14H15ClF3N5O6S |
| Molecular Weight | 473.82 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-(6-amino-2-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl trifluoromethanesulfonate |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](COS(=O)(=O)C(F)(F)F)O[C@H]2n1cnc2c(N)nc(Cl)nc21 |
| InChI | InChI=1S/C14H15ClF3N5O6S/c1-13(2)28-7-5(3-26-30(24,25)14(16,17)18)27-11(8(7)29-13)23-4-20-6-9(19)21-12(15)22-10(6)23/h4-5,7-8,11H,3H2,1-2H3,(H2,19,21,22)/t5-,7-,8-,11-/m1/s1 |
| InChIKey | WNIJQAUINXOXTG-IOSLPCCCSA-N |
| XLogP | 1.35 |
| TPSA | 140.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.82 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|