C26H36ClN7O7S — CID 25047762
[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl N-(2-chlorobenzoyl)sulfamate;N,N-diethylethanamine (PubChem CID 25047762) has the molecular formula C26H36ClN7O7S and a molecular weight of 626.14 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl N-(2-chlorobenzoyl)sulfamate;N,N-diethylethanamine.
| Compound Name | [(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl N-(2-chlorobenzoyl)sulfamate;N,N-diethylethanamine |
|---|---|
| PubChem CID | 25047762 |
| Molecular Formula | C26H36ClN7O7S |
| Molecular Weight | 626.14 g/mol |
| Exact Mass | 625.21 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl N-(2-chlorobenzoyl)sulfamate;N,N-diethylethanamine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](COS(=O)(=O)NC(=O)c1ccccc1Cl)O[C@H]2n1cnc2c(N)ncnc21.CCN(CC)CC |
| InChI | InChI=1S/C20H21ClN6O7S.C6H15N/c1-20(2)33-14-12(7-31-35(29,30)26-18(28)10-5-3-4-6-11(10)21)32-19(15(14)34-20)27-9-25-13-16(22)23-8-24-17(13)27;1-4-7(5-2)6-3/h3-6,8-9,12,14-15,19H,7H2,1-2H3,(H,26,28)(H2,22,23,24);4-6H2,1-3H3/t12-,14-,15-,19-;/m1./s1 |
| InChIKey | JYUZRTJVVBTECV-CAUXPVPNSA-N |
| XLogP | 2.52 |
| TPSA | 173.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.14 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |