C16H16ClN7O7S — CID 25047725
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-(2-chloropyridine-3-carbonyl)sulfamate (PubChem CID 25047725) has the molecular formula C16H16ClN7O7S and a molecular weight of 485.87 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-(2-chloropyridine-3-carbonyl)sulfamate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-(2-chloropyridine-3-carbonyl)sulfamate |
|---|---|
| PubChem CID | 25047725 |
| Molecular Formula | C16H16ClN7O7S |
| Molecular Weight | 485.87 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-(2-chloropyridine-3-carbonyl)sulfamate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COS(=O)(=O)NC(=O)c2cccnc2Cl)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H16ClN7O7S/c17-12-7(2-1-3-19-12)15(27)23-32(28,29)30-4-8-10(25)11(26)16(31-8)24-6-22-9-13(18)20-5-21-14(9)24/h1-3,5-6,8,10-11,16,25-26H,4H2,(H,23,27)(H2,18,20,21)/t8-,10-,11-,16-/m1/s1 |
| InChIKey | FIZDMGJVEAVDQQ-YZVYYRORSA-N |
| XLogP | -1.23 |
| TPSA | 204.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.87 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|