C18H20N6O8S — CID 25053141
[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate (PubChem CID 25053141) has the molecular formula C18H20N6O8S and a molecular weight of 480.46 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate |
|---|---|
| PubChem CID | 25053141 |
| Molecular Formula | C18H20N6O8S |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate |
| SMILES | CNc1ncnc2c1ncn2[C@@H]1O[C@H](COS(=O)(=O)NC(=O)c2ccccc2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H20N6O8S/c1-19-15-12-16(21-7-20-15)24(8-22-12)18-14(27)13(26)11(32-18)6-31-33(29,30)23-17(28)9-4-2-3-5-10(9)25/h2-5,7-8,11,13-14,18,25-27H,6H2,1H3,(H,23,28)(H,19,20,21)/t11-,13-,14-,18-/m1/s1 |
| InChIKey | JMBLPGRAGFPTBC-XWXWGSFUSA-N |
| XLogP | -1.12 |
| TPSA | 198.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |