C23H22N6O8S — CID 25053418
[(2R,3S,4R,5R)-5-(6-amino-2-phenylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate (PubChem CID 25053418) has the molecular formula C23H22N6O8S and a molecular weight of 542.53 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-amino-2-phenylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-amino-2-phenylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate |
|---|---|
| PubChem CID | 25053418 |
| Molecular Formula | C23H22N6O8S |
| Molecular Weight | 542.53 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-amino-2-phenylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate |
| SMILES | Nc1nc(-c2ccccc2)nc2c1ncn2[C@@H]1O[C@H](COS(=O)(=O)NC(=O)c2ccccc2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C23H22N6O8S/c24-19-16-21(27-20(26-19)12-6-2-1-3-7-12)29(11-25-16)23-18(32)17(31)15(37-23)10-36-38(34,35)28-22(33)13-8-4-5-9-14(13)30/h1-9,11,15,17-18,23,30-32H,10H2,(H,28,33)(H2,24,26,27)/t15-,17-,18-,23-/m1/s1 |
| InChIKey | CSMBFVQVRVUQMI-CXIOKZBNSA-N |
| XLogP | 0.09 |
| TPSA | 212.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.53 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |