C31H38N10O9S — CID 25157834
[(2R,3S,4R,5R)-5-[6-amino-2-[4-(2-hydroxyphenyl)triazol-1-yl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate;N,N-diethylethanamine (PubChem CID 25157834) has the molecular formula C31H38N10O9S and a molecular weight of 726.77 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-amino-2-[4-(2-hydroxyphenyl)triazol-1-yl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate;N,N-diethylethanamine.
| Compound Name | [(2R,3S,4R,5R)-5-[6-amino-2-[4-(2-hydroxyphenyl)triazol-1-yl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate;N,N-diethylethanamine |
|---|---|
| PubChem CID | 25157834 |
| Molecular Formula | C31H38N10O9S |
| Molecular Weight | 726.77 g/mol |
| Exact Mass | 726.25 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-amino-2-[4-(2-hydroxyphenyl)triazol-1-yl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.Nc1nc(-n2cc(-c3ccccc3O)nn2)nc2c1ncn2[C@@H]1O[C@H](COS(=O)(=O)NC(=O)c2ccccc2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C25H23N9O9S.C6H15N/c26-21-18-22(29-25(28-21)34-9-14(30-32-34)12-5-1-3-7-15(12)35)33(11-27-18)24-20(38)19(37)17(43-24)10-42-44(40,41)31-23(39)13-6-2-4-8-16(13)36;1-4-7(5-2)6-3/h1-9,11,17,19-20,24,35-38H,10H2,(H,31,39)(H2,26,28,29);4-6H2,1-3H3/t17-,19-,20-,24-;/m1./s1 |
| InChIKey | UPISHSUNIPAFCQ-HPLROQDGSA-N |
| XLogP | 0.73 |
| TPSA | 266.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.77 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |