C30H36F3N7O8S — CID 127050595
[(2R,3S,4R,5R)-5-[4-amino-6-[4-(trifluoromethyl)phenyl]triazolo[4,5-c]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate;N,N-diethylethanamine (PubChem CID 127050595) has the molecular formula C30H36F3N7O8S and a molecular weight of 711.72 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[4-amino-6-[4-(trifluoromethyl)phenyl]triazolo[4,5-c]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate;N,N-diethylethanamine.
| Compound Name | [(2R,3S,4R,5R)-5-[4-amino-6-[4-(trifluoromethyl)phenyl]triazolo[4,5-c]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate;N,N-diethylethanamine |
|---|---|
| PubChem CID | 127050595 |
| Molecular Formula | C30H36F3N7O8S |
| Molecular Weight | 711.72 g/mol |
| Exact Mass | 711.23 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[4-amino-6-[4-(trifluoromethyl)phenyl]triazolo[4,5-c]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.Nc1nc(-c2ccc(C(F)(F)F)cc2)cc2c1nnn2[C@@H]1O[C@H](COS(=O)(=O)NC(=O)c2ccccc2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C24H21F3N6O8S.C6H15N/c25-24(26,27)12-7-5-11(6-8-12)14-9-15-18(21(28)29-14)30-32-33(15)23-20(36)19(35)17(41-23)10-40-42(38,39)31-22(37)13-3-1-2-4-16(13)34;1-4-7(5-2)6-3/h1-9,17,19-20,23,34-36H,10H2,(H2,28,29)(H,31,37);4-6H2,1-3H3/t17-,19-,20-,23-;/m1./s1 |
| InChIKey | WBAHFPKPLIKLTA-WAHRBHRYSA-N |
| XLogP | 2.46 |
| TPSA | 215.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.72 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |