C18H18F3N7O7S — CID 145288636
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[2-amino-4-(trifluoromethyl)benzoyl]sulfamate (PubChem CID 145288636) has the molecular formula C18H18F3N7O7S and a molecular weight of 533.45 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[2-amino-4-(trifluoromethyl)benzoyl]sulfamate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[2-amino-4-(trifluoromethyl)benzoyl]sulfamate |
|---|---|
| PubChem CID | 145288636 |
| Molecular Formula | C18H18F3N7O7S |
| Molecular Weight | 533.45 g/mol |
| Exact Mass | 533.09 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[2-amino-4-(trifluoromethyl)benzoyl]sulfamate |
| SMILES | Nc1cc(C(F)(F)F)ccc1C(=O)NS(=O)(=O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H18F3N7O7S/c19-18(20,21)7-1-2-8(9(22)3-7)16(31)27-36(32,33)34-4-10-12(29)13(30)17(35-10)28-6-26-11-14(23)24-5-25-15(11)28/h1-3,5-6,10,12-13,17,29-30H,4,22H2,(H,27,31)(H2,23,24,25)/t10-,12-,13-,17-/m1/s1 |
| InChIKey | QRPLEVQDGPYMTI-CNEMSGBDSA-N |
| XLogP | -0.68 |
| TPSA | 217.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.45 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|