C16H24N6O7S — CID 25113194
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-hexanoylsulfamate (PubChem CID 25113194) has the molecular formula C16H24N6O7S and a molecular weight of 444.47 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-hexanoylsulfamate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-hexanoylsulfamate |
|---|---|
| PubChem CID | 25113194 |
| Molecular Formula | C16H24N6O7S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-hexanoylsulfamate |
| SMILES | CCCCCC(=O)NS(=O)(=O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H24N6O7S/c1-2-3-4-5-10(23)21-30(26,27)28-6-9-12(24)13(25)16(29-9)22-8-20-11-14(17)18-7-19-15(11)22/h7-9,12-13,16,24-25H,2-6H2,1H3,(H,21,23)(H2,17,18,19)/t9-,12-,13-,16-/m1/s1 |
| InChIKey | YWTBZUGWPNUPRC-RVXWVPLUSA-N |
| XLogP | -1.01 |
| TPSA | 191.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|