C27H37ClN6O8S — CID 162644002
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[11-(3-chlorophenoxy)undecanoyl]sulfamate (PubChem CID 162644002) has the molecular formula C27H37ClN6O8S and a molecular weight of 641.15 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[11-(3-chlorophenoxy)undecanoyl]sulfamate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[11-(3-chlorophenoxy)undecanoyl]sulfamate |
|---|---|
| PubChem CID | 162644002 |
| Molecular Formula | C27H37ClN6O8S |
| Molecular Weight | 641.15 g/mol |
| Exact Mass | 640.21 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[11-(3-chlorophenoxy)undecanoyl]sulfamate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COS(=O)(=O)NC(=O)CCCCCCCCCCOc2cccc(Cl)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C27H37ClN6O8S/c28-18-10-9-11-19(14-18)40-13-8-6-4-2-1-3-5-7-12-21(35)33-43(38,39)41-15-20-23(36)24(37)27(42-20)34-17-32-22-25(29)30-16-31-26(22)34/h9-11,14,16-17,20,23-24,27,36-37H,1-8,12-13,15H2,(H,33,35)(H2,29,30,31)/t20-,23-,24-,27-/m1/s1 |
| InChIKey | HCNVNKQSYOYDSV-ZCIWVVNKSA-N |
| XLogP | 2.65 |
| TPSA | 201.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.15 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|