C11H15N5O9S2 — CID 164817715
[(2R,3R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxysulfonylmethanesulfonic acid (PubChem CID 164817715) has the molecular formula C11H15N5O9S2 and a molecular weight of 425.40 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxysulfonylmethanesulfonic acid.
| Compound Name | [(2R,3R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxysulfonylmethanesulfonic acid |
|---|---|
| PubChem CID | 164817715 |
| Molecular Formula | C11H15N5O9S2 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | [(2R,3R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxysulfonylmethanesulfonic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COS(=O)(=O)CS(=O)(=O)O)[C@H](O)C1O |
| InChI | InChI=1S/C11H15N5O9S2/c12-9-6-10(14-2-13-9)16(3-15-6)11-8(18)7(17)5(25-11)1-24-27(22,23)4-26(19,20)21/h2-3,5,7-8,11,17-18H,1,4H2,(H2,12,13,14)(H,19,20,21)/t5-,7+,8?,11-/m1/s1 |
| InChIKey | OQZZCIRYJAXVEO-INWNYVOZSA-N |
| XLogP | -2.78 |
| TPSA | 217.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|