C13H17N5O10S2 — CID 164817725
[(4R,6R,6aS)-4-(6-aminopurin-9-yl)-2-methoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxysulfonylmethanesulfonic acid (PubChem CID 164817725) has the molecular formula C13H17N5O10S2 and a molecular weight of 467.44 g/mol. Its IUPAC name is [(4R,6R,6aS)-4-(6-aminopurin-9-yl)-2-methoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxysulfonylmethanesulfonic acid.
| Compound Name | [(4R,6R,6aS)-4-(6-aminopurin-9-yl)-2-methoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxysulfonylmethanesulfonic acid |
|---|---|
| PubChem CID | 164817725 |
| Molecular Formula | C13H17N5O10S2 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | [(4R,6R,6aS)-4-(6-aminopurin-9-yl)-2-methoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxysulfonylmethanesulfonic acid |
| SMILES | COC1OC2[C@@H](O1)[C@@H](COS(=O)(=O)CS(=O)(=O)O)O[C@H]2n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C13H17N5O10S2/c1-24-13-27-8-6(2-25-30(22,23)5-29(19,20)21)26-12(9(8)28-13)18-4-17-7-10(14)15-3-16-11(7)18/h3-4,6,8-9,12-13H,2,5H2,1H3,(H2,14,15,16)(H,19,20,21)/t6-,8+,9?,12-,13?/m1/s1 |
| InChIKey | FBKXHEWBKUDQBT-HZGNGHQASA-N |
| XLogP | -1.79 |
| TPSA | 204.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|