C24H25N5O11P2 — CID 10919211
[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2-methoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] diphenyl phosphate (PubChem CID 10919211) has the molecular formula C24H25N5O11P2 and a molecular weight of 621.44 g/mol. Its IUPAC name is [[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2-methoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] diphenyl phosphate.
| Compound Name | [[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2-methoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] diphenyl phosphate |
|---|---|
| PubChem CID | 10919211 |
| Molecular Formula | C24H25N5O11P2 |
| Molecular Weight | 621.44 g/mol |
| Exact Mass | 621.10 |
| IUPAC Name | [[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2-methoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] diphenyl phosphate |
| SMILES | COC1O[C@@H]2[C@H](O1)[C@@H](COP(=O)(O)OP(=O)(Oc1ccccc1)Oc1ccccc1)O[C@H]2n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C24H25N5O11P2/c1-33-24-36-19-17(35-23(20(19)37-24)29-14-28-18-21(25)26-13-27-22(18)29)12-34-41(30,31)40-42(32,38-15-8-4-2-5-9-15)39-16-10-6-3-7-11-16/h2-11,13-14,17,19-20,23-24H,12H2,1H3,(H,30,31)(H2,25,26,27)/t17-,19-,20-,23-,24?/m1/s1 |
| InChIKey | VFLHWEXJJIUUHF-LNTKWDIKSA-N |
| XLogP | 3.42 |
| TPSA | 197.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|