C14H18N5O13P3S — CID 88625888
[[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono thiophen-2-yl phosphate (PubChem CID 88625888) has the molecular formula C14H18N5O13P3S and a molecular weight of 589.31 g/mol. Its IUPAC name is [[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono thiophen-2-yl phosphate.
| Compound Name | [[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono thiophen-2-yl phosphate |
|---|---|
| PubChem CID | 88625888 |
| Molecular Formula | C14H18N5O13P3S |
| Molecular Weight | 589.31 g/mol |
| Exact Mass | 588.98 |
| IUPAC Name | [[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono thiophen-2-yl phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(Oc2cccs2)OP(=O)(O)O)C(O)C1O |
| InChI | InChI=1S/C14H18N5O13P3S/c15-12-9-13(17-5-16-12)19(6-18-9)14-11(21)10(20)7(29-14)4-28-34(25,26)32-35(27,31-33(22,23)24)30-8-2-1-3-36-8/h1-3,5-7,10-11,14,20-21H,4H2,(H,25,26)(H2,15,16,17)(H2,22,23,24)/t7-,10?,11?,14-,35?/m1/s1 |
| InChIKey | JHUJKHIIKPYIKX-IJOKASFISA-N |
| XLogP | 0.52 |
| TPSA | 268.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|