C16H19BrN5O13P3 — CID 87329546
[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(4-bromophenoxy)-hydroxyphosphoryl] hydrogen phosphate (PubChem CID 87329546) has the molecular formula C16H19BrN5O13P3 and a molecular weight of 662.18 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(4-bromophenoxy)-hydroxyphosphoryl] hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(4-bromophenoxy)-hydroxyphosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 87329546 |
| Molecular Formula | C16H19BrN5O13P3 |
| Molecular Weight | 662.18 g/mol |
| Exact Mass | 660.94 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(4-bromophenoxy)-hydroxyphosphoryl] hydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)Oc2ccc(Br)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H19BrN5O13P3/c17-8-1-3-9(4-2-8)33-37(27,28)35-38(29,30)34-36(25,26)31-5-10-12(23)13(24)16(32-10)22-7-21-11-14(18)19-6-20-15(11)22/h1-4,6-7,10,12-13,16,23-24H,5H2,(H,25,26)(H,27,28)(H,29,30)(H2,18,19,20)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | HSQQXVFLVMKUBI-XNIJJKJLSA-N |
| XLogP | 1.22 |
| TPSA | 268.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|