C28H28N5O13P3 — CID 10240447
[[(4R,6R)-4-(6-aminopurin-9-yl)-2-benzyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] [hydroxy(naphthalen-2-yloxy)phosphoryl] hydrogen phosphate (PubChem CID 10240447) has the molecular formula C28H28N5O13P3 and a molecular weight of 735.48 g/mol. Its IUPAC name is [[(4R,6R)-4-(6-aminopurin-9-yl)-2-benzyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] [hydroxy(naphthalen-2-yloxy)phosphoryl] hydrogen phosphate.
| Compound Name | [[(4R,6R)-4-(6-aminopurin-9-yl)-2-benzyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] [hydroxy(naphthalen-2-yloxy)phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 10240447 |
| Molecular Formula | C28H28N5O13P3 |
| Molecular Weight | 735.48 g/mol |
| Exact Mass | 735.09 |
| IUPAC Name | [[(4R,6R)-4-(6-aminopurin-9-yl)-2-benzyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] [hydroxy(naphthalen-2-yloxy)phosphoryl] hydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)Oc2ccc3ccccc3c2)C2OC(Cc3ccccc3)OC21 |
| InChI | InChI=1S/C28H28N5O13P3/c29-26-23-27(31-15-30-26)33(16-32-23)28-25-24(42-22(43-25)12-17-6-2-1-3-7-17)21(41-28)14-40-47(34,35)45-49(38,39)46-48(36,37)44-20-11-10-18-8-4-5-9-19(18)13-20/h1-11,13,15-16,21-22,24-25,28H,12,14H2,(H,34,35)(H,36,37)(H,38,39)(H2,29,30,31)/t21-,22?,24?,25?,28-/m1/s1 |
| InChIKey | LFLQWQOIWQVCMF-XIICJHMCSA-N |
| XLogP | 4.24 |
| TPSA | 246.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|