C20H23N6O13P3 — CID 87347656
(6-aminonaphthalen-1-yl) [[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate (PubChem CID 87347656) has the molecular formula C20H23N6O13P3 and a molecular weight of 648.36 g/mol. Its IUPAC name is (6-aminonaphthalen-1-yl) [[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate.
| Compound Name | (6-aminonaphthalen-1-yl) [[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 87347656 |
| Molecular Formula | C20H23N6O13P3 |
| Molecular Weight | 648.36 g/mol |
| Exact Mass | 648.05 |
| IUPAC Name | (6-aminonaphthalen-1-yl) [[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate |
| SMILES | Nc1ccc2c(OP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)cccc2c1 |
| InChI | InChI=1S/C20H23N6O13P3/c21-11-4-5-12-10(6-11)2-1-3-13(12)37-41(31,32)39-42(33,34)38-40(29,30)35-7-14-16(27)17(28)20(36-14)26-9-25-15-18(22)23-8-24-19(15)26/h1-6,8-9,14,16-17,20,27-28H,7,21H2,(H,29,30)(H,31,32)(H,33,34)(H2,22,23,24)/t14-,16-,17-,20-/m1/s1 |
| InChIKey | IUPWMNUSPZQOJR-WVSUBDOOSA-N |
| XLogP | 1.19 |
| TPSA | 294.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|