C20H21ClN5O13P3 — CID 87154199
[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(4-chloronaphthalen-1-yl)oxy-hydroxyphosphoryl] hydrogen phosphate (PubChem CID 87154199) has the molecular formula C20H21ClN5O13P3 and a molecular weight of 667.79 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(4-chloronaphthalen-1-yl)oxy-hydroxyphosphoryl] hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(4-chloronaphthalen-1-yl)oxy-hydroxyphosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 87154199 |
| Molecular Formula | C20H21ClN5O13P3 |
| Molecular Weight | 667.79 g/mol |
| Exact Mass | 667.00 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(4-chloronaphthalen-1-yl)oxy-hydroxyphosphoryl] hydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)Oc2ccc(Cl)c3ccccc23)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H21ClN5O13P3/c21-12-5-6-13(11-4-2-1-3-10(11)12)37-41(31,32)39-42(33,34)38-40(29,30)35-7-14-16(27)17(28)20(36-14)26-9-25-15-18(22)23-8-24-19(15)26/h1-6,8-9,14,16-17,20,27-28H,7H2,(H,29,30)(H,31,32)(H,33,34)(H2,22,23,24)/t14-,16-,17-,20-/m1/s1 |
| InChIKey | DUNPDAVFCDWJIC-WVSUBDOOSA-N |
| XLogP | 2.26 |
| TPSA | 268.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.79 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|