C20H19N5O16P4-4 — CID 58989340
[[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [[naphthalen-1-yloxy(oxido)phosphoryl]oxy-oxidophosphoryl] phosphate (PubChem CID 58989340) has the molecular formula C20H19N5O16P4-4 and a molecular weight of 709.29 g/mol. Its IUPAC name is [[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [[naphthalen-1-yloxy(oxido)phosphoryl]oxy-oxidophosphoryl] phosphate.
| Compound Name | [[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [[naphthalen-1-yloxy(oxido)phosphoryl]oxy-oxidophosphoryl] phosphate |
|---|---|
| PubChem CID | 58989340 |
| Molecular Formula | C20H19N5O16P4-4 |
| Molecular Weight | 709.29 g/mol |
| Exact Mass | 708.98 |
| IUPAC Name | [[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [[naphthalen-1-yloxy(oxido)phosphoryl]oxy-oxidophosphoryl] phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])Oc2cccc3ccccc23)C(O)[C@@H]1O |
| InChI | InChI=1S/C20H23N5O16P4/c21-18-15-19(23-9-22-18)25(10-24-15)20-17(27)16(26)14(37-20)8-36-42(28,29)39-44(32,33)41-45(34,35)40-43(30,31)38-13-7-3-5-11-4-1-2-6-12(11)13/h1-7,9-10,14,16-17,20,26-27H,8H2,(H,28,29)(H,30,31)(H,32,33)(H,34,35)(H2,21,22,23)/p-4/t14-,16?,17+,20-/m1/s1 |
| InChIKey | XALPVYMWZWKLGR-ASQPVTKTSA-J |
| XLogP | -0.80 |
| TPSA | 325.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.29 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|