C17H19N5O13P3-3 — CID 58989277
[[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [oxido(phenylmethoxy)phosphoryl] phosphate (PubChem CID 58989277) has the molecular formula C17H19N5O13P3-3 and a molecular weight of 594.28 g/mol. Its IUPAC name is [[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [oxido(phenylmethoxy)phosphoryl] phosphate.
| Compound Name | [[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [oxido(phenylmethoxy)phosphoryl] phosphate |
|---|---|
| PubChem CID | 58989277 |
| Molecular Formula | C17H19N5O13P3-3 |
| Molecular Weight | 594.28 g/mol |
| Exact Mass | 594.02 |
| IUPAC Name | [[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [oxido(phenylmethoxy)phosphoryl] phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OCc2ccccc2)C(O)[C@@H]1O |
| InChI | InChI=1S/C17H22N5O13P3/c18-15-12-16(20-8-19-15)22(9-21-12)17-14(24)13(23)11(33-17)7-32-37(27,28)35-38(29,30)34-36(25,26)31-6-10-4-2-1-3-5-10/h1-5,8-9,11,13-14,17,23-24H,6-7H2,(H,25,26)(H,27,28)(H,29,30)(H2,18,19,20)/p-3/t11-,13?,14+,17-/m1/s1 |
| InChIKey | DRPSFGSQHDZADR-OVHGWZCWSA-K |
| XLogP | -1.30 |
| TPSA | 276.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.28 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|