C22H23N5O9P2S — CID 101035340
[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] diphenyl phosphate (PubChem CID 101035340) has the molecular formula C22H23N5O9P2S and a molecular weight of 595.47 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] diphenyl phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] diphenyl phosphate |
|---|---|
| PubChem CID | 101035340 |
| Molecular Formula | C22H23N5O9P2S |
| Molecular Weight | 595.47 g/mol |
| Exact Mass | 595.07 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] diphenyl phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(O)(=S)OP(=O)(Oc2ccccc2)Oc2ccccc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H23N5O9P2S/c23-20-17-21(25-12-24-20)27(13-26-17)22-19(29)18(28)16(33-22)11-32-38(31,39)36-37(30,34-14-7-3-1-4-8-14)35-15-9-5-2-6-10-15/h1-10,12-13,16,18-19,22,28-29H,11H2,(H,31,39)(H2,23,24,25)/t16-,18-,19-,22-,38?/m1/s1 |
| InChIKey | PFZFXIPCOMACOV-QDNVVNCNSA-N |
| XLogP | 2.54 |
| TPSA | 193.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|