C12H20N5O11P3S2 — CID 177468365
[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl]oxymethyl-[[hydroxy(sulfanyl)phosphoryl]oxymethyl]phosphinic acid (PubChem CID 177468365) has the molecular formula C12H20N5O11P3S2 and a molecular weight of 567.37 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl]oxymethyl-[[hydroxy(sulfanyl)phosphoryl]oxymethyl]phosphinic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl]oxymethyl-[[hydroxy(sulfanyl)phosphoryl]oxymethyl]phosphinic acid |
|---|---|
| PubChem CID | 177468365 |
| Molecular Formula | C12H20N5O11P3S2 |
| Molecular Weight | 567.37 g/mol |
| Exact Mass | 566.98 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl]oxymethyl-[[hydroxy(sulfanyl)phosphoryl]oxymethyl]phosphinic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(O)(=S)OCP(=O)(O)COP(=O)(O)S)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H20N5O11P3S2/c13-10-7-11(15-2-14-10)17(3-16-7)12-9(19)8(18)6(28-12)1-25-31(24,33)27-5-29(20,21)4-26-30(22,23)32/h2-3,6,8-9,12,18-19H,1,4-5H2,(H,20,21)(H,24,33)(H2,13,14,15)(H2,22,23,32)/t6-,8-,9-,12-,31?/m1/s1 |
| InChIKey | MHBILXGLKLKAON-ODOFCFNBSA-N |
| XLogP | -0.49 |
| TPSA | 241.83 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.37 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|