C13H19N5O10P2 — CID 58971959
[(4S,6S)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl phosphono hydrogen phosphate (PubChem CID 58971959) has the molecular formula C13H19N5O10P2 and a molecular weight of 467.27 g/mol. Its IUPAC name is [(4S,6S)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(4S,6S)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 58971959 |
| Molecular Formula | C13H19N5O10P2 |
| Molecular Weight | 467.27 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | [(4S,6S)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl phosphono hydrogen phosphate |
| SMILES | CC1(C)OC2C(O1)[C@@H](n1cnc3c(N)ncnc31)O[C@H]2COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C13H19N5O10P2/c1-13(2)26-8-6(3-24-30(22,23)28-29(19,20)21)25-12(9(8)27-13)18-5-17-7-10(14)15-4-16-11(7)18/h4-6,8-9,12H,3H2,1-2H3,(H,22,23)(H2,14,15,16)(H2,19,20,21)/t6-,8?,9?,12-/m0/s1 |
| InChIKey | NQWCGPFAGYDGAZ-BLWDTKHVSA-N |
| XLogP | 0.05 |
| TPSA | 210.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.27 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|