C22H37N5O16P2 — CID 166946570
[[4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] [(3S,7R)-3,4,5,7,8-pentahydroxy-6-methoxyoctyl] hydrogen phosphate (PubChem CID 166946570) has the molecular formula C22H37N5O16P2 and a molecular weight of 689.50 g/mol. Its IUPAC name is [[4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] [(3S,7R)-3,4,5,7,8-pentahydroxy-6-methoxyoctyl] hydrogen phosphate.
| Compound Name | [[4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] [(3S,7R)-3,4,5,7,8-pentahydroxy-6-methoxyoctyl] hydrogen phosphate |
|---|---|
| PubChem CID | 166946570 |
| Molecular Formula | C22H37N5O16P2 |
| Molecular Weight | 689.50 g/mol |
| Exact Mass | 689.17 |
| IUPAC Name | [[4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] [(3S,7R)-3,4,5,7,8-pentahydroxy-6-methoxyoctyl] hydrogen phosphate |
| SMILES | COC(C(O)C(O)[C@@H](O)CCOP(=O)(O)OP(=O)(O)OCC1OC(n2cnc3c(N)ncnc32)C2OC(C)(C)OC12)[C@H](O)CO |
| InChI | InChI=1S/C22H37N5O16P2/c1-22(2)41-17-12(40-21(18(17)42-22)27-9-26-13-19(23)24-8-25-20(13)27)7-39-45(35,36)43-44(33,34)38-5-4-10(29)14(31)15(32)16(37-3)11(30)6-28/h8-12,14-18,21,28-32H,4-7H2,1-3H3,(H,33,34)(H,35,36)(H2,23,24,25)/t10-,11+,12?,14?,15?,16?,17?,18?,21?/m0/s1 |
| InChIKey | SOUZUIVTWZWREH-BBLDTKAKSA-N |
| XLogP | -2.08 |
| TPSA | 309.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.50 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|